5H,6H,7H-pyrrolo[1,2-a]iMidazole - Names and Identifiers
Name | 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole
|
Synonyms | 5H,6H,7H-pyrrolo[1,2-a]iMidazole 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole 5H-pyrrolo[1,2-a]imidazole, 6,7-dihydro- 5H-Pyrrolo[1,2-a]imidazole, 6,7-dihydro-
|
CAS | 59646-16-1
|
InChI | InChI=1/C6H8N2/c1-2-6-7-3-5-8(6)4-1/h3,5H,1-2,4H2 |
5H,6H,7H-pyrrolo[1,2-a]iMidazole - Physico-chemical Properties
Molecular Formula | C6H8N2
|
Molar Mass | 108.14 |
Density | 1.23g/cm3 |
Boling Point | 260.8°C at 760 mmHg |
Flash Point | 111.5°C |
Vapor Presure | 0.0194mmHg at 25°C |
Storage Condition | 2-8°C |
Sensitive | Toxic |
Refractive Index | 1.657 |
MDL | MFCD11870771 |
5H,6H,7H-pyrrolo[1,2-a]iMidazole - Introduction
6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole is a nitrogen-containing heterocyclic compound with the following properties:
1. Appearance: colorless or light yellow crystal.
2. hydrochloride: is a common derivative, often in the form of hydrochloric acid.
3. flammability: 6,7-Dihydro-5H-Pyrrolo [1,2-a]imidazole is flammable and requires fire prevention measures during storage and handling.
The application of 6,7-Dihydro-5H-cryrolo [1,2-a]imidazole mainly includes the following aspects:
1. intermediates in chemical reactions: as a heterocyclic compound, 6,7-Dihydro-5H-cryolo [1,2-a]imidazole can be used as intermediates in various organic synthesis reactions, such as aromatization, hydrogenation and substitution reactions.
2. Drug research: Due to its unique structure and properties, 6,7-Dihydro-5H-Pyrrolo [1,2-a]imidazole also has certain application value in drug research and can be used to synthesize new compounds with biological activity.
Regarding the preparation method of 6,7-Dihydro-5H-yrrolo [1,2-a]imidazole, a common method is synthesis through imidazole cyclization reaction. Specific preparation methods can be understood in more detail by reference to literature or patent literature.
When using and handling 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole, note the following safety information:
1. fire and explosion prevention: 6,7-Dihydro-5H-Pyrrolo [1,2-a]imidazole is combustible, heating or contact with oxidant may cause fire or explosion. During storage and operation, avoid contact with open flames or high temperature substances.
2. Personal protection: When handling 6,7-Dihydro-5H-Pyrrolo [1,2-a]imidazole, personal protective equipment such as protective glasses, gloves and protective clothing should be worn to avoid skin irritation or eye damage caused by direct contact.
3. Environmental protection: Avoid discharging 6,7-Dihydro-5H-Pyrrolo [1,2-a]imidazole into water bodies or sewage systems. Waste should be disposed of properly and in compliance with relevant environmental protection regulations.
Last Update:2024-04-09 21:54:55